C17H29NOSi — CID 10266298
(E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxybut-3-enenitrile (PubChem CID 10266298) has the molecular formula C17H29NOSi and a molecular weight of 291.51 g/mol. Its IUPAC name is (E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxybut-3-enenitrile.
| Compound Name | (E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxybut-3-enenitrile |
|---|---|
| PubChem CID | 10266298 |
| Molecular Formula | C17H29NOSi |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxybut-3-enenitrile |
| SMILES | CC1=C(/C=C/C(C)(C#N)O[Si](C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H29NOSi/c1-14-9-8-11-16(2,3)15(14)10-12-17(4,13-18)19-20(5,6)7/h10,12H,8-9,11H2,1-7H3/b12-10+ |
| InChIKey | RPVSAZRHMMFIEK-ZRDIBKRKSA-N |
| XLogP | 5.20 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|