C21H40OSi — CID 15440980
triethyl-[(Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxysilane (PubChem CID 15440980) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is triethyl-[(Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxysilane.
| Compound Name | triethyl-[(Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 15440980 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | triethyl-[(Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxysilane |
| SMILES | CCC(C)(/C=C\C1=C(C)CCCC1(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H40OSi/c1-9-21(8,22-23(10-2,11-3)12-4)17-15-19-18(5)14-13-16-20(19,6)7/h15,17H,9-14,16H2,1-8H3/b17-15- |
| InChIKey | ZKLCVVMRXYPEAL-ICFOKQHNSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|