C22H38OSi — CID 10617605
(3E)-4-(2,6,6-trimethylcyclohexen-1-yl)-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one (PubChem CID 10617605) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is (3E)-4-(2,6,6-trimethylcyclohexen-1-yl)-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one.
| Compound Name | (3E)-4-(2,6,6-trimethylcyclohexen-1-yl)-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one |
|---|---|
| PubChem CID | 10617605 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (3E)-4-(2,6,6-trimethylcyclohexen-1-yl)-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one |
| SMILES | CC1=C(/C=C/C(=C=O)[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H38OSi/c1-16(2)24(17(3)4,18(5)6)20(15-23)12-13-21-19(7)11-10-14-22(21,8)9/h12-13,16-18H,10-11,14H2,1-9H3/b13-12+ |
| InChIKey | GQVDOZLWUNZSJO-OUKQBFOZSA-N |
| XLogP | 7.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|