C19H32OSi — CID 86719927
[(1E)-1-(2,2,3,4,5,5-hexamethyl-6-methylidenecyclohex-3-en-1-ylidene)prop-2-enoxy]-trimethylsilane (PubChem CID 86719927) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is [(1E)-1-(2,2,3,4,5,5-hexamethyl-6-methylidenecyclohex-3-en-1-ylidene)prop-2-enoxy]-trimethylsilane.
| Compound Name | [(1E)-1-(2,2,3,4,5,5-hexamethyl-6-methylidenecyclohex-3-en-1-ylidene)prop-2-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 86719927 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [(1E)-1-(2,2,3,4,5,5-hexamethyl-6-methylidenecyclohex-3-en-1-ylidene)prop-2-enoxy]-trimethylsilane |
| SMILES | C=C/C(O[Si](C)(C)C)=C1\C(=C)C(C)(C)C(C)=C(C)C1(C)C |
| InChI | InChI=1S/C19H32OSi/c1-12-16(20-21(9,10)11)17-15(4)18(5,6)13(2)14(3)19(17,7)8/h12H,1,4H2,2-3,5-11H3/b17-16- |
| InChIKey | UNFPWJIMCPWLHE-MSUUIHNZSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|