C15H21NO — CID 101116799
(4aR,8aS)-2-(4-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine (PubChem CID 101116799) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (4aR,8aS)-2-(4-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (4aR,8aS)-2-(4-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 101116799 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (4aR,8aS)-2-(4-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
| SMILES | Cc1ccc(C2NC[C@H]3CCCC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C15H21NO/c1-11-6-8-12(9-7-11)15-16-10-13-4-2-3-5-14(13)17-15/h6-9,13-16H,2-5,10H2,1H3/t13-,14+,15?/m1/s1 |
| InChIKey | IUHSNRMKWXXUHH-GNXJLENFSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |