C10H13NO3S3 — CID 101124243
(4-methoxyphenyl)sulfonyl N,N-dimethylcarbamodithioate (PubChem CID 101124243) has the molecular formula C10H13NO3S3 and a molecular weight of 291.42 g/mol. Its IUPAC name is (4-methoxyphenyl)sulfonyl N,N-dimethylcarbamodithioate.
| Compound Name | (4-methoxyphenyl)sulfonyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 101124243 |
| Molecular Formula | C10H13NO3S3 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (4-methoxyphenyl)sulfonyl N,N-dimethylcarbamodithioate |
| SMILES | COc1ccc(S(=O)(=O)SC(=S)N(C)C)cc1 |
| InChI | InChI=1S/C10H13NO3S3/c1-11(2)10(15)16-17(12,13)9-6-4-8(14-3)5-7-9/h4-7H,1-3H3 |
| InChIKey | PJZZTCOQFSQMPJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|