C24H21N5S — CID 101124286
2-[[4-[[4-[ethyl(2-thiophen-3-ylethyl)amino]phenyl]diazenyl]phenyl]methylidene]propanedinitrile (PubChem CID 101124286) has the molecular formula C24H21N5S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-[[4-[[4-[ethyl(2-thiophen-3-ylethyl)amino]phenyl]diazenyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[[4-[ethyl(2-thiophen-3-ylethyl)amino]phenyl]diazenyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 101124286 |
| Molecular Formula | C24H21N5S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[[4-[[4-[ethyl(2-thiophen-3-ylethyl)amino]phenyl]diazenyl]phenyl]methylidene]propanedinitrile |
| SMILES | CCN(CCc1ccsc1)c1ccc(/N=N/c2ccc(C=C(C#N)C#N)cc2)cc1 |
| InChI | InChI=1S/C24H21N5S/c1-2-29(13-11-20-12-14-30-18-20)24-9-7-23(8-10-24)28-27-22-5-3-19(4-6-22)15-21(16-25)17-26/h3-10,12,14-15,18H,2,11,13H2,1H3/b28-27+ |
| InChIKey | URTVZHVMQNTLDE-BYYHNAKLSA-N |
| XLogP | 6.66 |
| TPSA | 75.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|