C16H22N2O2 — CID 101128555
N-methyl-N-[(Z)-[(2S,4R,6S)-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-ylidene]amino]methanamine (PubChem CID 101128555) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-methyl-N-[(Z)-[(2S,4R,6S)-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-ylidene]amino]methanamine.
| Compound Name | N-methyl-N-[(Z)-[(2S,4R,6S)-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-ylidene]amino]methanamine |
|---|---|
| PubChem CID | 101128555 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-methyl-N-[(Z)-[(2S,4R,6S)-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-ylidene]amino]methanamine |
| SMILES | C=CC[C@@H]1O[C@@H](c2ccccc2)O[C@H](C)/C1=N/N(C)C |
| InChI | InChI=1S/C16H22N2O2/c1-5-9-14-15(17-18(3)4)12(2)19-16(20-14)13-10-7-6-8-11-13/h5-8,10-12,14,16H,1,9H2,2-4H3/b17-15-/t12-,14+,16+/m1/s1 |
| InChIKey | XECJDOCUMBRAPA-JLDRCWTNSA-N |
| XLogP | 2.98 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|