C15H19N3O2 — CID 57267080
(4R,5S)-5-azido-4-pent-1-enyl-2-phenyl-1,3-dioxane (PubChem CID 57267080) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (4R,5S)-5-azido-4-pent-1-enyl-2-phenyl-1,3-dioxane.
| Compound Name | (4R,5S)-5-azido-4-pent-1-enyl-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 57267080 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (4R,5S)-5-azido-4-pent-1-enyl-2-phenyl-1,3-dioxane |
| SMILES | CCCC=C[C@H]1OC(c2ccccc2)OC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C15H19N3O2/c1-2-3-5-10-14-13(17-18-16)11-19-15(20-14)12-8-6-4-7-9-12/h4-10,13-15H,2-3,11H2,1H3/t13-,14+,15?/m0/s1 |
| InChIKey | IWSDSIMDBQTVFU-SNTRVMSOSA-N |
| XLogP | 4.14 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|