C19H16ClN3O4S — CID 101129743
ethyl 2-[[3-chloro-4-(2,5-dioxopyrrol-1-yl)phenyl]diazenyl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 101129743) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is ethyl 2-[[3-chloro-4-(2,5-dioxopyrrol-1-yl)phenyl]diazenyl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-chloro-4-(2,5-dioxopyrrol-1-yl)phenyl]diazenyl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 101129743 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl 2-[[3-chloro-4-(2,5-dioxopyrrol-1-yl)phenyl]diazenyl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(/N=N/c2ccc(N3C(=O)C=CC3=O)c(Cl)c2)sc(C)c1C |
| InChI | InChI=1S/C19H16ClN3O4S/c1-4-27-19(26)17-10(2)11(3)28-18(17)22-21-12-5-6-14(13(20)9-12)23-15(24)7-8-16(23)25/h5-9H,4H2,1-3H3/b22-21+ |
| InChIKey | YPJNKOIDDPRRIZ-QURGRASLSA-N |
| XLogP | 5.04 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|