C22H21N3O6S — CID 13008004
diethyl 5-[[4-(2,5-dioxopyrrol-1-yl)-3-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 13008004) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is diethyl 5-[[4-(2,5-dioxopyrrol-1-yl)-3-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[4-(2,5-dioxopyrrol-1-yl)-3-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 13008004 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | diethyl 5-[[4-(2,5-dioxopyrrol-1-yl)-3-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(/N=N/c2ccc(N3C(=O)C=CC3=O)c(C)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H21N3O6S/c1-5-30-21(28)18-13(4)19(22(29)31-6-2)32-20(18)24-23-14-7-8-15(12(3)11-14)25-16(26)9-10-17(25)27/h7-11H,5-6H2,1-4H3/b24-23+ |
| InChIKey | JJOQOUDBZRFUPF-WCWDXBQESA-N |
| XLogP | 4.56 |
| TPSA | 114.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|