C17H23NO2S — CID 101130661
(1E,3E)-N-butyl-4-phenyl-N-prop-2-enylbuta-1,3-diene-1-sulfonamide (PubChem CID 101130661) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is (1E,3E)-N-butyl-4-phenyl-N-prop-2-enylbuta-1,3-diene-1-sulfonamide.
| Compound Name | (1E,3E)-N-butyl-4-phenyl-N-prop-2-enylbuta-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 101130661 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (1E,3E)-N-butyl-4-phenyl-N-prop-2-enylbuta-1,3-diene-1-sulfonamide |
| SMILES | C=CCN(CCCC)S(=O)(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H23NO2S/c1-3-5-15-18(14-4-2)21(19,20)16-10-9-13-17-11-7-6-8-12-17/h4,6-13,16H,2-3,5,14-15H2,1H3/b13-9+,16-10+ |
| InChIKey | BHTXAPWIZIOKRR-WVLBTEBZSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|