C12H15NO2S — CID 15075079
(1E,3E)-N,N-dimethyl-4-phenylbuta-1,3-diene-1-sulfonamide (PubChem CID 15075079) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (1E,3E)-N,N-dimethyl-4-phenylbuta-1,3-diene-1-sulfonamide.
| Compound Name | (1E,3E)-N,N-dimethyl-4-phenylbuta-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 15075079 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (1E,3E)-N,N-dimethyl-4-phenylbuta-1,3-diene-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H15NO2S/c1-13(2)16(14,15)11-7-6-10-12-8-4-3-5-9-12/h3-11H,1-2H3/b10-6+,11-7+ |
| InChIKey | XEMTZDBJOJTVSS-JMQWPVDRSA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|