C15H16O — CID 101135942
(1S,2S)-2-pent-4-ynyl-1,2-dihydronaphthalen-1-ol (PubChem CID 101135942) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (1S,2S)-2-pent-4-ynyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-pent-4-ynyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 101135942 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (1S,2S)-2-pent-4-ynyl-1,2-dihydronaphthalen-1-ol |
| SMILES | C#CCCC[C@H]1C=Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C15H16O/c1-2-3-4-8-13-11-10-12-7-5-6-9-14(12)15(13)16/h1,5-7,9-11,13,15-16H,3-4,8H2/t13-,15-/m0/s1 |
| InChIKey | SUVBVOUVPQYDNE-ZFWWWQNUSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|