C20H17ClN2OS3 — CID 10113693
N-[(4-chlorophenyl)methyl]-7-ethyl-2-(3-hydroxyprop-1-ynyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carbothioamide (PubChem CID 10113693) has the molecular formula C20H17ClN2OS3 and a molecular weight of 433.02 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-7-ethyl-2-(3-hydroxyprop-1-ynyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carbothioamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-7-ethyl-2-(3-hydroxyprop-1-ynyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 10113693 |
| Molecular Formula | C20H17ClN2OS3 |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-7-ethyl-2-(3-hydroxyprop-1-ynyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carbothioamide |
| SMILES | CCn1cc(C(=S)NCc2ccc(Cl)cc2)c(=S)c2cc(C#CCO)sc21 |
| InChI | InChI=1S/C20H17ClN2OS3/c1-2-23-12-17(19(26)22-11-13-5-7-14(21)8-6-13)18(25)16-10-15(4-3-9-24)27-20(16)23/h5-8,10,12,24H,2,9,11H2,1H3,(H,22,26) |
| InChIKey | IQXGEVOIAAFJAZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|