C15H23O2S+ — CID 101139441
(2S)-3-[(2S,3R)-3-butyl-1-phenylthiiran-1-ium-2-yl]propane-1,2-diol (PubChem CID 101139441) has the molecular formula C15H23O2S+ and a molecular weight of 267.41 g/mol. Its IUPAC name is (2S)-3-[(2S,3R)-3-butyl-1-phenylthiiran-1-ium-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2S,3R)-3-butyl-1-phenylthiiran-1-ium-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 101139441 |
| Molecular Formula | C15H23O2S+ |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (2S)-3-[(2S,3R)-3-butyl-1-phenylthiiran-1-ium-2-yl]propane-1,2-diol |
| SMILES | CCCC[C@@H]1[C@H](C[C@H](O)CO)[S+]1c1ccccc1 |
| InChI | InChI=1S/C15H23O2S/c1-2-3-9-14-15(10-12(17)11-16)18(14)13-7-5-4-6-8-13/h4-8,12,14-17H,2-3,9-11H2,1H3/q+1/t12-,14+,15-,18?/m0/s1 |
| InChIKey | PBDMTUNMKHQYSS-KEAFFXMMSA-N |
| XLogP | 2.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|