C20H24Cl2O8S2 — CID 11752850
(15S,16S)-15-butyl-16-ethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate (PubChem CID 11752850) has the molecular formula C20H24Cl2O8S2 and a molecular weight of 527.44 g/mol. Its IUPAC name is (15S,16S)-15-butyl-16-ethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate.
| Compound Name | (15S,16S)-15-butyl-16-ethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate |
|---|---|
| PubChem CID | 11752850 |
| Molecular Formula | C20H24Cl2O8S2 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | (15S,16S)-15-butyl-16-ethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate |
| SMILES | CCCC[C@H]1[C@H](CC)[S+]2c3ccccc3[S+]1c1ccccc12.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H24S2.2ClHO4/c1-3-5-10-16-15(4-2)21-17-11-6-8-13-19(17)22(16)20-14-9-7-12-18(20)21;2*2-1(3,4)5/h6-9,11-16H,3-5,10H2,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2/t15-,16-,21?,22?;;/m0../s1 |
| InChIKey | FWAWOOFEKLHEBH-VLTZXQFDSA-L |
| XLogP | -4.09 |
| TPSA | 184.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|