About 2-phenylethynyl 4-chlorobenzenesulfinate
2-phenylethynyl 4-chlorobenzenesulfinate (PubChem CID 101139542) has the molecular formula C14H9ClO2S
and a molecular weight of 276.74 g/mol. Its IUPAC name is 2-phenylethynyl 4-chlorobenzenesulfinate.
Molecular Properties
| Compound Name | 2-phenylethynyl 4-chlorobenzenesulfinate |
| PubChem CID | 101139542 |
| Molecular Formula | C14H9ClO2S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 2-phenylethynyl 4-chlorobenzenesulfinate |
| SMILES | O=S(OC#Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9ClO2S/c15-13-6-8-14(9-7-13)18(16)17-11-10-12-4-2-1-3-5-12/h1-9H |
| InChIKey | NQACEERMKUGIHC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethynyl 4-chlorobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethynyl 4-chlorobenzenesulfinate?
The IUPAC name of 2-phenylethynyl 4-chlorobenzenesulfinate (CID 101139542) is 2-phenylethynyl 4-chlorobenzenesulfinate.
What is the SMILES notation for 2-phenylethynyl 4-chlorobenzenesulfinate?
The canonical SMILES for 2-phenylethynyl 4-chlorobenzenesulfinate is O=S(OC#Cc1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of 2-phenylethynyl 4-chlorobenzenesulfinate?
The InChIKey is NQACEERMKUGIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClO2S/c15-13-6-8-14(9-7-13)18(16)17-11-10-12-4-2-1-3-5-12/h1-9H.
What are the key properties of 2-phenylethynyl 4-chlorobenzenesulfinate?
2-phenylethynyl 4-chlorobenzenesulfinate has a molecular weight of 276.74 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethynyl 4-chlorobenzenesulfinate is sourced from PubChem (CID 101139542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).