C11H14O8 — CID 101143739
[(3aR,4S,7R,7aS)-7-methoxycarbonyloxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] methyl carbonate (PubChem CID 101143739) has the molecular formula C11H14O8 and a molecular weight of 274.23 g/mol. Its IUPAC name is [(3aR,4S,7R,7aS)-7-methoxycarbonyloxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] methyl carbonate.
| Compound Name | [(3aR,4S,7R,7aS)-7-methoxycarbonyloxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 101143739 |
| Molecular Formula | C11H14O8 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [(3aR,4S,7R,7aS)-7-methoxycarbonyloxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1C=C[C@@H](OC(=O)OC)[C@@H]2OCO[C@@H]21 |
| InChI | InChI=1S/C11H14O8/c1-14-10(12)18-6-3-4-7(19-11(13)15-2)9-8(6)16-5-17-9/h3-4,6-9H,5H2,1-2H3/t6-,7+,8+,9- |
| InChIKey | FILUVBLGLUCVMK-OJOKCITNSA-N |
| XLogP | 0.60 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|