C18H19N7O3S — CID 101146400
(1S,2R,3S,4R)-4-[6-amino-2-[2-(1,3-thiazol-2-yl)ethynyl]purin-9-yl]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide (PubChem CID 101146400) has the molecular formula C18H19N7O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[6-amino-2-[2-(1,3-thiazol-2-yl)ethynyl]purin-9-yl]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R)-4-[6-amino-2-[2-(1,3-thiazol-2-yl)ethynyl]purin-9-yl]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 101146400 |
| Molecular Formula | C18H19N7O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (1S,2R,3S,4R)-4-[6-amino-2-[2-(1,3-thiazol-2-yl)ethynyl]purin-9-yl]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide |
| SMILES | CCNC(=O)[C@H]1C[C@@H](n2cnc3c(N)nc(C#Cc4nccs4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19N7O3S/c1-2-20-18(28)9-7-10(15(27)14(9)26)25-8-22-13-16(19)23-11(24-17(13)25)3-4-12-21-5-6-29-12/h5-6,8-10,14-15,26-27H,2,7H2,1H3,(H,20,28)(H2,19,23,24)/t9-,10+,14+,15-/m0/s1 |
| InChIKey | WVGBLGLFIHCZCD-RZCHIYRCSA-N |
| XLogP | -0.32 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|