C16H19NO — CID 101152474
(7aS,11aS)-6-ethenyl-7a,8,9,10,11,11a-hexahydro-5H-benzo[d][2]benzazepin-7-one (PubChem CID 101152474) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (7aS,11aS)-6-ethenyl-7a,8,9,10,11,11a-hexahydro-5H-benzo[d][2]benzazepin-7-one.
| Compound Name | (7aS,11aS)-6-ethenyl-7a,8,9,10,11,11a-hexahydro-5H-benzo[d][2]benzazepin-7-one |
|---|---|
| PubChem CID | 101152474 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (7aS,11aS)-6-ethenyl-7a,8,9,10,11,11a-hexahydro-5H-benzo[d][2]benzazepin-7-one |
| SMILES | C=CN1Cc2ccccc2[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C16H19NO/c1-2-17-11-12-7-3-4-8-13(12)14-9-5-6-10-15(14)16(17)18/h2-4,7-8,14-15H,1,5-6,9-11H2/t14-,15+/m1/s1 |
| InChIKey | YJKIGVKJHOIXGJ-CABCVRRESA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |