C20H32O4SSi — CID 101158411
ethyl (2R,3R)-2-(4-methoxyphenyl)-3-triethylsilyl-1,4-oxathiane-3-carboxylate (PubChem CID 101158411) has the molecular formula C20H32O4SSi and a molecular weight of 396.63 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(4-methoxyphenyl)-3-triethylsilyl-1,4-oxathiane-3-carboxylate.
| Compound Name | ethyl (2R,3R)-2-(4-methoxyphenyl)-3-triethylsilyl-1,4-oxathiane-3-carboxylate |
|---|---|
| PubChem CID | 101158411 |
| Molecular Formula | C20H32O4SSi |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | ethyl (2R,3R)-2-(4-methoxyphenyl)-3-triethylsilyl-1,4-oxathiane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1([Si](CC)(CC)CC)SCCO[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H32O4SSi/c1-6-23-19(21)20(26(7-2,8-3)9-4)18(24-14-15-25-20)16-10-12-17(22-5)13-11-16/h10-13,18H,6-9,14-15H2,1-5H3/t18-,20+/m1/s1 |
| InChIKey | PZSRILITVZAIQS-QUCCMNQESA-N |
| XLogP | 4.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|