C9H14O3Si — CID 101175779
(1S,5R,6R)-5-trimethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 101175779) has the molecular formula C9H14O3Si and a molecular weight of 198.29 g/mol. Its IUPAC name is (1S,5R,6R)-5-trimethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6R)-5-trimethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 101175779 |
| Molecular Formula | C9H14O3Si |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (1S,5R,6R)-5-trimethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | C[Si](C)(C)O[C@@H]1C=CC(=O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C9H14O3Si/c1-13(2,3)12-7-5-4-6(10)8-9(7)11-8/h4-5,7-9H,1-3H3/t7-,8-,9+/m1/s1 |
| InChIKey | PCFHBFGBLSDUAW-HLTSFMKQSA-N |
| XLogP | 1.11 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|