C16H22OSi — CID 101177918
trimethyl-[(E)-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-ylidenemethyl]silane (PubChem CID 101177918) has the molecular formula C16H22OSi and a molecular weight of 258.44 g/mol. Its IUPAC name is trimethyl-[(E)-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-ylidenemethyl]silane.
| Compound Name | trimethyl-[(E)-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-ylidenemethyl]silane |
|---|---|
| PubChem CID | 101177918 |
| Molecular Formula | C16H22OSi |
| Molecular Weight | 258.44 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | trimethyl-[(E)-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-ylidenemethyl]silane |
| SMILES | C[Si](C)(C)/C=C1\CCC2OC1Cc1ccccc12 |
| InChI | InChI=1S/C16H22OSi/c1-18(2,3)11-13-8-9-15-14-7-5-4-6-12(14)10-16(13)17-15/h4-7,11,15-16H,8-10H2,1-3H3/b13-11+ |
| InChIKey | XPMDZFYZIKGEPZ-ACCUITESSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|