C20H20O3 — CID 10968849
(1R,9R)-3-methoxy-5-[(E)-prop-1-enyl]-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-6-ol (PubChem CID 10968849) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (1R,9R)-3-methoxy-5-[(E)-prop-1-enyl]-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-6-ol.
| Compound Name | (1R,9R)-3-methoxy-5-[(E)-prop-1-enyl]-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-6-ol |
|---|---|
| PubChem CID | 10968849 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1R,9R)-3-methoxy-5-[(E)-prop-1-enyl]-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-6-ol |
| SMILES | C/C=C/c1cc(OC)c2c(c1O)C[C@H]1O[C@@H]2Cc2ccccc21 |
| InChI | InChI=1S/C20H20O3/c1-3-6-13-10-17(22-2)19-15(20(13)21)11-16-14-8-5-4-7-12(14)9-18(19)23-16/h3-8,10,16,18,21H,9,11H2,1-2H3/b6-3+/t16-,18-/m1/s1 |
| InChIKey | LFTFLMFUZPHESK-AWHHDIADSA-N |
| XLogP | 4.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |