C29H32O2Si — CID 101229420
tert-butyl-[(E)-[(1S,8R)-13-oxatricyclo[6.4.1.02,7]trideca-2,4,6-trien-10-ylidene]methoxy]-diphenylsilane (PubChem CID 101229420) has the molecular formula C29H32O2Si and a molecular weight of 440.66 g/mol. Its IUPAC name is tert-butyl-[(E)-[(1S,8R)-13-oxatricyclo[6.4.1.02,7]trideca-2,4,6-trien-10-ylidene]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-[(1S,8R)-13-oxatricyclo[6.4.1.02,7]trideca-2,4,6-trien-10-ylidene]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101229420 |
| Molecular Formula | C29H32O2Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | tert-butyl-[(E)-[(1S,8R)-13-oxatricyclo[6.4.1.02,7]trideca-2,4,6-trien-10-ylidene]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](O/C=C1\CC[C@@H]2O[C@H](C1)c1ccccc12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32O2Si/c1-29(2,3)32(23-12-6-4-7-13-23,24-14-8-5-9-15-24)30-21-22-18-19-27-25-16-10-11-17-26(25)28(20-22)31-27/h4-17,21,27-28H,18-20H2,1-3H3/b22-21+/t27-,28+/m0/s1 |
| InChIKey | ZLWBOVZUHHHVAT-RRKDMDGFSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|