C17H31BrO2Si — CID 101179869
[(2S,4S,6R)-2-[(E)-4-bromobut-1-enyl]-6-ethenyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101179869) has the molecular formula C17H31BrO2Si and a molecular weight of 375.42 g/mol. Its IUPAC name is [(2S,4S,6R)-2-[(E)-4-bromobut-1-enyl]-6-ethenyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4S,6R)-2-[(E)-4-bromobut-1-enyl]-6-ethenyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101179869 |
| Molecular Formula | C17H31BrO2Si |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(2S,4S,6R)-2-[(E)-4-bromobut-1-enyl]-6-ethenyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](/C=C/CCBr)O1 |
| InChI | InChI=1S/C17H31BrO2Si/c1-7-14-12-16(20-21(5,6)17(2,3)4)13-15(19-14)10-8-9-11-18/h7-8,10,14-16H,1,9,11-13H2,2-6H3/b10-8+/t14-,15+,16-/m0/s1 |
| InChIKey | BDRWFIKLWJVEOR-BGVICRPBSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|