C26H50O4Si2 — CID 101181545
(3Z,5S,6S,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-3,7-dien-1-ol (PubChem CID 101181545) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is (3Z,5S,6S,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-3,7-dien-1-ol.
| Compound Name | (3Z,5S,6S,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-3,7-dien-1-ol |
|---|---|
| PubChem CID | 101181545 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (3Z,5S,6S,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-3,7-dien-1-ol |
| SMILES | CC1=CCO[C@H](/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C\CCO)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H50O4Si2/c1-21-17-19-28-22(20-21)15-16-24(30-32(10,11)26(5,6)7)23(14-12-13-18-27)29-31(8,9)25(2,3)4/h12,14-17,22-24,27H,13,18-20H2,1-11H3/b14-12-,16-15+/t22-,23+,24+/m1/s1 |
| InChIKey | LATNJCUUCFEZIA-WARPKJEGSA-N |
| XLogP | 7.00 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|