C15H24O4 — CID 101183099
(2R,4S,7R,12R)-12-(hydroxymethyl)-2,4,8,10-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-ol (PubChem CID 101183099) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2R,4S,7R,12R)-12-(hydroxymethyl)-2,4,8,10-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-ol.
| Compound Name | (2R,4S,7R,12R)-12-(hydroxymethyl)-2,4,8,10-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-ol |
|---|---|
| PubChem CID | 101183099 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2R,4S,7R,12R)-12-(hydroxymethyl)-2,4,8,10-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-ol |
| SMILES | CC1=C[C@H](CO)C2(O[C@H](C)C[C@H](C)O2)[C@H](O)C(C)=C1 |
| InChI | InChI=1S/C15H24O4/c1-9-5-10(2)14(17)15(13(6-9)8-16)18-11(3)7-12(4)19-15/h5-6,11-14,16-17H,7-8H2,1-4H3/t11-,12+,13-,14-,15?/m1/s1 |
| InChIKey | ZRRKYUONLHZEGN-PFNKYVCDSA-N |
| XLogP | 1.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |