C17H24O — CID 101185630
(1R)-1-[(1S)-2-methylcyclohept-2-en-1-yl]-3-phenylpropan-1-ol (PubChem CID 101185630) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R)-1-[(1S)-2-methylcyclohept-2-en-1-yl]-3-phenylpropan-1-ol.
| Compound Name | (1R)-1-[(1S)-2-methylcyclohept-2-en-1-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101185630 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1R)-1-[(1S)-2-methylcyclohept-2-en-1-yl]-3-phenylpropan-1-ol |
| SMILES | CC1=CCCCC[C@@H]1[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C17H24O/c1-14-8-4-2-7-11-16(14)17(18)13-12-15-9-5-3-6-10-15/h3,5-6,8-10,16-18H,2,4,7,11-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | KKXGUDPALDTPQC-DLBZAZTESA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|