C15H21NO4 — CID 101186888
[(2R)-1-[[(2E,4E)-hexa-2,4-dienoyl]amino]-1-hydroxypropan-2-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 101186888) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(2R)-1-[[(2E,4E)-hexa-2,4-dienoyl]amino]-1-hydroxypropan-2-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(2R)-1-[[(2E,4E)-hexa-2,4-dienoyl]amino]-1-hydroxypropan-2-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 101186888 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [(2R)-1-[[(2E,4E)-hexa-2,4-dienoyl]amino]-1-hydroxypropan-2-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)NC(O)[C@@H](C)OC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C15H21NO4/c1-4-6-8-10-13(17)16-15(19)12(3)20-14(18)11-9-7-5-2/h4-12,15,19H,1-3H3,(H,16,17)/b6-4+,7-5+,10-8+,11-9+/t12-,15?/m1/s1 |
| InChIKey | GEYXWGBYRJAAMK-PBWBBBFBSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|