C13H21NO3 — CID 81004460
tert-butyl (2R)-2-[[(4E)-hexa-2,4-dienoyl]amino]propanoate (PubChem CID 81004460) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(4E)-hexa-2,4-dienoyl]amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[[(4E)-hexa-2,4-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 81004460 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl (2R)-2-[[(4E)-hexa-2,4-dienoyl]amino]propanoate |
| SMILES | C/C=C/C=CC(=O)N[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO3/c1-6-7-8-9-11(15)14-10(2)12(16)17-13(3,4)5/h6-10H,1-5H3,(H,14,15)/b7-6+,9-8?/t10-/m1/s1 |
| InChIKey | VSNOSKRCQGGEKD-YAITXBSFSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|