C9H11F4NO2 — CID 101192929
3-(1,1,2,2-tetrafluoroethyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol (PubChem CID 101192929) has the molecular formula C9H11F4NO2 and a molecular weight of 241.18 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol.
| Compound Name | 3-(1,1,2,2-tetrafluoroethyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol |
|---|---|
| PubChem CID | 101192929 |
| Molecular Formula | C9H11F4NO2 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol |
| SMILES | OC1(C(F)(F)C(F)F)ON=C2CCCCC21 |
| InChI | InChI=1S/C9H11F4NO2/c10-7(11)8(12,13)9(15)5-3-1-2-4-6(5)14-16-9/h5,7,15H,1-4H2 |
| InChIKey | CDEWRZLKNPVHIF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|