C11H11F8NO2 — CID 91872051
3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol (PubChem CID 91872051) has the molecular formula C11H11F8NO2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol.
| Compound Name | 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol |
|---|---|
| PubChem CID | 91872051 |
| Molecular Formula | C11H11F8NO2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)C(F)F)ON=C2CCCCC21 |
| InChI | InChI=1S/C11H11F8NO2/c12-7(13)8(14,15)10(16,17)11(18,19)9(21)5-3-1-2-4-6(5)20-22-9/h5,7,21H,1-4H2 |
| InChIKey | FCRFXZFNZGRPOR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|