C13H10F13NO2 — CID 91872052
3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol (PubChem CID 91872052) has the molecular formula C13H10F13NO2 and a molecular weight of 459.20 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol |
|---|---|
| PubChem CID | 91872052 |
| Molecular Formula | C13H10F13NO2 |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ON=C2CCCCC21 |
| InChI | InChI=1S/C13H10F13NO2/c14-8(15,7(28)5-3-1-2-4-6(5)27-29-7)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h5,28H,1-4H2 |
| InChIKey | SPOZZOHANLQLMV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|