C10H8F9NO2 — CID 12965265
3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol (PubChem CID 12965265) has the molecular formula C10H8F9NO2 and a molecular weight of 345.16 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol.
| Compound Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol |
|---|---|
| PubChem CID | 12965265 |
| Molecular Formula | C10H8F9NO2 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ON=C2CCCC21 |
| InChI | InChI=1S/C10H8F9NO2/c11-7(12,8(13,14)9(15,16)10(17,18)19)6(21)4-2-1-3-5(4)20-22-6/h4,21H,1-3H2 |
| InChIKey | AECSFAIEKJSLSU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|