C8H9F4NO2 — CID 91872147
3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol (PubChem CID 91872147) has the molecular formula C8H9F4NO2 and a molecular weight of 227.16 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol.
| Compound Name | 3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol |
|---|---|
| PubChem CID | 91872147 |
| Molecular Formula | C8H9F4NO2 |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6-tetrahydrocyclopenta[c][1,2]oxazol-3-ol |
| SMILES | OC1(C(F)(F)C(F)F)ON=C2CCCC21 |
| InChI | InChI=1S/C8H9F4NO2/c9-6(10)7(11,12)8(14)4-2-1-3-5(4)13-15-8/h4,6,14H,1-3H2 |
| InChIKey | OWCKGRBSPFVMFV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|