C31H42O6Si — CID 101194681
[(2R,3R,4R,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-[(2R,3S)-2-ethenyloxan-3-yl]-dimethylsilane (PubChem CID 101194681) has the molecular formula C31H42O6Si and a molecular weight of 538.76 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-[(2R,3S)-2-ethenyloxan-3-yl]-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-[(2R,3S)-2-ethenyloxan-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101194681 |
| Molecular Formula | C31H42O6Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-[(2R,3S)-2-ethenyloxan-3-yl]-dimethylsilane |
| SMILES | C=C[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)[C@H]1CCCO[C@@H]1C=C |
| InChI | InChI=1S/C31H42O6Si/c1-6-25-27(19-14-20-33-25)38(4,5)37-28-26(7-2)36-31(32-3)30(35-22-24-17-12-9-13-18-24)29(28)34-21-23-15-10-8-11-16-23/h6-13,15-18,25-31H,1-2,14,19-22H2,3-5H3/t25-,26-,27+,28-,29+,30-,31+/m1/s1 |
| InChIKey | QZFAPLJZMRXLMQ-MSHMWPAYSA-N |
| XLogP | 6.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|