C32H44O6Si — CID 100970687
tert-butyl-[4-[(3R,4S,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxybut-2-ynoxy]-dimethylsilane (PubChem CID 100970687) has the molecular formula C32H44O6Si and a molecular weight of 552.78 g/mol. Its IUPAC name is tert-butyl-[4-[(3R,4S,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxybut-2-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[(3R,4S,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxybut-2-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 100970687 |
| Molecular Formula | C32H44O6Si |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | tert-butyl-[4-[(3R,4S,5R,6S)-2-ethenyl-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxybut-2-ynoxy]-dimethylsilane |
| SMILES | C=CC1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H44O6Si/c1-8-27-28(34-21-15-16-22-37-39(6,7)32(2,3)4)29(35-23-25-17-11-9-12-18-25)30(31(33-5)38-27)36-24-26-19-13-10-14-20-26/h8-14,17-20,27-31H,1,21-24H2,2-7H3/t27?,28-,29+,30-,31+/m1/s1 |
| InChIKey | CTNNUAJTDMMMTC-VEOMERKBSA-N |
| XLogP | 6.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|