C28H46O7Si — CID 11398320
(1R,5S,6S,7R,8S,9R)-6-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methyl-9-phenylmethoxy-8-prop-2-enoxy-2,4-dioxabicyclo[3.3.1]nonan-7-ol (PubChem CID 11398320) has the molecular formula C28H46O7Si and a molecular weight of 522.76 g/mol. Its IUPAC name is (1R,5S,6S,7R,8S,9R)-6-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methyl-9-phenylmethoxy-8-prop-2-enoxy-2,4-dioxabicyclo[3.3.1]nonan-7-ol.
| Compound Name | (1R,5S,6S,7R,8S,9R)-6-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methyl-9-phenylmethoxy-8-prop-2-enoxy-2,4-dioxabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 11398320 |
| Molecular Formula | C28H46O7Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (1R,5S,6S,7R,8S,9R)-6-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methyl-9-phenylmethoxy-8-prop-2-enoxy-2,4-dioxabicyclo[3.3.1]nonan-7-ol |
| SMILES | C=CCO[C@H]1[C@H](O)[C@H](OCCCCO[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)O[C@H]1[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C28H46O7Si/c1-8-16-30-23-22(29)24(31-17-12-13-18-33-36(6,7)28(3,4)5)27-25(26(23)34-20(2)35-27)32-19-21-14-10-9-11-15-21/h8-11,14-15,20,22-27,29H,1,12-13,16-19H2,2-7H3/t20?,22-,23-,24-,25-,26+,27-/m0/s1 |
| InChIKey | MRGFPVPMXDZJGX-SRERTFRFSA-N |
| XLogP | 4.83 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|