C45H50O7Si — CID 10996220
[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-pent-4-enoxy-diphenylsilane (PubChem CID 10996220) has the molecular formula C45H50O7Si and a molecular weight of 730.97 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-pent-4-enoxy-diphenylsilane.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-pent-4-enoxy-diphenylsilane |
|---|---|
| PubChem CID | 10996220 |
| Molecular Formula | C45H50O7Si |
| Molecular Weight | 730.97 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-pent-4-enoxy-diphenylsilane |
| SMILES | C=CCCCO[Si](OC[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H50O7Si/c1-3-4-20-31-50-53(39-27-16-8-17-28-39,40-29-18-9-19-30-40)51-35-41-42(47-32-36-21-10-5-11-22-36)43(48-33-37-23-12-6-13-24-37)44(45(46-2)52-41)49-34-38-25-14-7-15-26-38/h3,5-19,21-30,41-45H,1,4,20,31-35H2,2H3/t41-,42-,43+,44-,45+/m1/s1 |
| InChIKey | NDLWLJOVZLJDTJ-NUFGPDMYSA-N |
| XLogP | 7.37 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.97 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|