C15H28I2Si — CID 101198044
[(1Z,3Z)-3-butyl-1,4-diiodoocta-1,3-dienyl]-trimethylsilane (PubChem CID 101198044) has the molecular formula C15H28I2Si and a molecular weight of 490.28 g/mol. Its IUPAC name is [(1Z,3Z)-3-butyl-1,4-diiodoocta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-3-butyl-1,4-diiodoocta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 101198044 |
| Molecular Formula | C15H28I2Si |
| Molecular Weight | 490.28 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | [(1Z,3Z)-3-butyl-1,4-diiodoocta-1,3-dienyl]-trimethylsilane |
| SMILES | CCCC/C(I)=C(/C=C(\I)[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C15H28I2Si/c1-6-8-10-13(14(16)11-9-7-2)12-15(17)18(3,4)5/h12H,6-11H2,1-5H3/b14-13-,15-12+ |
| InChIKey | RDVJDWWDKVVWOB-GKWZYGEFSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.28 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|