C28H30O4 — CID 101199839
1,2-bis[(E)-3-ethoxy-1-phenylprop-1-enoxy]benzene (PubChem CID 101199839) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is 1,2-bis[(E)-3-ethoxy-1-phenylprop-1-enoxy]benzene.
| Compound Name | 1,2-bis[(E)-3-ethoxy-1-phenylprop-1-enoxy]benzene |
|---|---|
| PubChem CID | 101199839 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1,2-bis[(E)-3-ethoxy-1-phenylprop-1-enoxy]benzene |
| SMILES | CCOC/C=C(/Oc1ccccc1O/C(=C/COCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30O4/c1-3-29-21-19-25(23-13-7-5-8-14-23)31-27-17-11-12-18-28(27)32-26(20-22-30-4-2)24-15-9-6-10-16-24/h5-20H,3-4,21-22H2,1-2H3/b25-19+,26-20+ |
| InChIKey | MXYRLIMXYDCGQJ-FQHZWJPGSA-N |
| XLogP | 6.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|