C33H50BrF2O3P — CID 101201802
1-bromo-4-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-difluoro-3,6-dioctylbenzene (PubChem CID 101201802) has the molecular formula C33H50BrF2O3P and a molecular weight of 643.63 g/mol. Its IUPAC name is 1-bromo-4-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-difluoro-3,6-dioctylbenzene.
| Compound Name | 1-bromo-4-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-difluoro-3,6-dioctylbenzene |
|---|---|
| PubChem CID | 101201802 |
| Molecular Formula | C33H50BrF2O3P |
| Molecular Weight | 643.63 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | 1-bromo-4-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-difluoro-3,6-dioctylbenzene |
| SMILES | CCCCCCCCc1c(F)c(-c2ccc(CP(=O)(OCC)OCC)cc2)c(CCCCCCCC)c(F)c1Br |
| InChI | InChI=1S/C33H50BrF2O3P/c1-5-9-11-13-15-17-19-28-30(27-23-21-26(22-24-27)25-40(37,38-7-3)39-8-4)32(35)29(31(34)33(28)36)20-18-16-14-12-10-6-2/h21-24H,5-20,25H2,1-4H3 |
| InChIKey | FJLFUOQAKPMJFT-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.63 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|