C12H15F3N2O6 — CID 101202818
(2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)oxyamino]hexanoate (PubChem CID 101202818) has the molecular formula C12H15F3N2O6 and a molecular weight of 340.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)oxyamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)oxyamino]hexanoate |
|---|---|
| PubChem CID | 101202818 |
| Molecular Formula | C12H15F3N2O6 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)oxyamino]hexanoate |
| SMILES | O=C(CCCCCNOC(=O)C(F)(F)F)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H15F3N2O6/c13-12(14,15)11(21)22-16-7-3-1-2-4-10(20)23-17-8(18)5-6-9(17)19/h16H,1-7H2 |
| InChIKey | KWTRABIKHZMMML-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|