C15H18NO4 — CID 101205767
CID 101205767 (PubChem CID 101205767) has the molecular formula C15H18NO4 and a molecular weight of 276.31 g/mol.
| Compound Name | CID 101205767 |
|---|---|
| PubChem CID | 101205767 |
| Molecular Formula | C15H18NO4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | — |
| SMILES | CC1(C)N([O])C(C)(C)[C@]2(c3ccccc3)O[C@]12C(=O)O |
| InChI | InChI=1S/C15H18NO4/c1-12(2)14(10-8-6-5-7-9-10)15(20-14,11(17)18)13(3,4)16(12)19/h5-9H,1-4H3,(H,17,18)/t14-,15+/m0/s1 |
| InChIKey | HTPZNDUBFPAUIE-LSDHHAIUSA-N |
| XLogP | 1.95 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|