C17H20O4 — CID 101209179
(1S,3S,4R,5R)-1-hydroxy-4-phenylmethoxy-3-prop-2-enyl-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 101209179) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1S,3S,4R,5R)-1-hydroxy-4-phenylmethoxy-3-prop-2-enyl-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,3S,4R,5R)-1-hydroxy-4-phenylmethoxy-3-prop-2-enyl-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 101209179 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1S,3S,4R,5R)-1-hydroxy-4-phenylmethoxy-3-prop-2-enyl-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | C=CC[C@H]1C[C@]2(O)C[C@@H](OC2=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H20O4/c1-2-6-13-9-17(19)10-14(21-16(17)18)15(13)20-11-12-7-4-3-5-8-12/h2-5,7-8,13-15,19H,1,6,9-11H2/t13-,14+,15+,17-/m0/s1 |
| InChIKey | CZDHKOIPOWIBGA-HWMZRRJGSA-N |
| XLogP | 2.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|