C10H15Cl3N2O3 — CID 101210335
(2S)-6-amino-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]hexanoic acid (PubChem CID 101210335) has the molecular formula C10H15Cl3N2O3 and a molecular weight of 317.60 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101210335 |
| Molecular Formula | C10H15Cl3N2O3 |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (2S)-6-amino-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](N/C=C\C(=O)C(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C10H15Cl3N2O3/c11-10(12,13)8(16)4-6-15-7(9(17)18)3-1-2-5-14/h4,6-7,15H,1-3,5,14H2,(H,17,18)/b6-4-/t7-/m0/s1 |
| InChIKey | NGGNMYXASGXYPY-NGAMADIESA-N |
| XLogP | 1.61 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|