C29H45NO2SSi — CID 101214738
4-methyl-N-[(E)-3-methyl-1-phenyl-6-tri(propan-2-yl)silyloxyhex-2-enyl]benzenesulfinamide (PubChem CID 101214738) has the molecular formula C29H45NO2SSi and a molecular weight of 499.84 g/mol. Its IUPAC name is 4-methyl-N-[(E)-3-methyl-1-phenyl-6-tri(propan-2-yl)silyloxyhex-2-enyl]benzenesulfinamide.
| Compound Name | 4-methyl-N-[(E)-3-methyl-1-phenyl-6-tri(propan-2-yl)silyloxyhex-2-enyl]benzenesulfinamide |
|---|---|
| PubChem CID | 101214738 |
| Molecular Formula | C29H45NO2SSi |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 4-methyl-N-[(E)-3-methyl-1-phenyl-6-tri(propan-2-yl)silyloxyhex-2-enyl]benzenesulfinamide |
| SMILES | C/C(=C\C(NS(=O)c1ccc(C)cc1)c1ccccc1)CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H45NO2SSi/c1-22(2)34(23(3)4,24(5)6)32-20-12-13-26(8)21-29(27-14-10-9-11-15-27)30-33(31)28-18-16-25(7)17-19-28/h9-11,14-19,21-24,29-30H,12-13,20H2,1-8H3/b26-21+ |
| InChIKey | ORTXOYDDYBXIMV-YYADALCUSA-N |
| XLogP | 8.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|