C21H36O4Si — CID 101217884
dimethyl (3E,4Z)-3-propylidene-4-(1-triethylsilylpropylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 101217884) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is dimethyl (3E,4Z)-3-propylidene-4-(1-triethylsilylpropylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,4Z)-3-propylidene-4-(1-triethylsilylpropylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101217884 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | dimethyl (3E,4Z)-3-propylidene-4-(1-triethylsilylpropylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CC/C=C1\CC(C(=O)OC)(C(=O)OC)C\C1=C(/CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H36O4Si/c1-8-13-16-14-21(19(22)24-6,20(23)25-7)15-17(16)18(9-2)26(10-3,11-4)12-5/h13H,8-12,14-15H2,1-7H3/b16-13+,18-17- |
| InChIKey | OCKCBYLGSKQJFB-XJQDBPQSSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|